C25H27FO6 — CID 134245634
[3-[4-(4-fluorobutyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl] (E)-2-(hydroxymethyl)but-2-enoate (PubChem CID 134245634) has the molecular formula C25H27FO6 and a molecular weight of 442.48 g/mol. Its IUPAC name is [3-[4-(4-fluorobutyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl] (E)-2-(hydroxymethyl)but-2-enoate.
| Compound Name | [3-[4-(4-fluorobutyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl] (E)-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 134245634 |
| Molecular Formula | C25H27FO6 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [3-[4-(4-fluorobutyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl] (E)-2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C(CO)C(=O)Oc1cc(OC(=O)/C(=C/C)CO)cc(-c2ccc(CCCCF)cc2)c1 |
| InChI | InChI=1S/C25H27FO6/c1-3-19(16-28)25(30)32-23-13-21(12-22(14-23)31-24(29)17(2)15-27)20-9-7-18(8-10-20)6-4-5-11-26/h3,7-10,12-14,27-28H,2,4-6,11,15-16H2,1H3/b19-3+ |
| InChIKey | KRZIKNDDSHGAFR-QBROUFQSSA-N |
| XLogP | 3.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|