C41H58O6 — CID 139442850
2-[2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-nonylphenyl]-5-[2-(oxan-4-ylmethoxy)ethyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139442850) has the molecular formula C41H58O6 and a molecular weight of 646.91 g/mol. Its IUPAC name is 2-[2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-nonylphenyl]-5-[2-(oxan-4-ylmethoxy)ethyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-nonylphenyl]-5-[2-(oxan-4-ylmethoxy)ethyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139442850 |
| Molecular Formula | C41H58O6 |
| Molecular Weight | 646.91 g/mol |
| Exact Mass | 646.42 |
| IUPAC Name | 2-[2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-nonylphenyl]-5-[2-(oxan-4-ylmethoxy)ethyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(CCOCC3CCOCC3)cc2CCOC(=O)C(=C)C)ccc1CCCCCCCCC |
| InChI | InChI=1S/C41H58O6/c1-6-7-8-9-10-11-12-13-35-15-16-37(29-36(35)21-26-46-40(42)31(2)3)39-17-14-33(18-25-45-30-34-19-23-44-24-20-34)28-38(39)22-27-47-41(43)32(4)5/h14-17,28-29,34H,2,4,6-13,18-27,30H2,1,3,5H3 |
| InChIKey | DFXRNFQUBIIBBX-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.91 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|