C47H64O8 — CID 155238515
2-[2-[4-[3,3-bis(hydroxymethyl)hexoxy]-3-[2-(4-prop-1-en-2-yloxetan-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 155238515) has the molecular formula C47H64O8 and a molecular weight of 757.02 g/mol. Its IUPAC name is 2-[2-[4-[3,3-bis(hydroxymethyl)hexoxy]-3-[2-(4-prop-1-en-2-yloxetan-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-[3,3-bis(hydroxymethyl)hexoxy]-3-[2-(4-prop-1-en-2-yloxetan-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155238515 |
| Molecular Formula | C47H64O8 |
| Molecular Weight | 757.02 g/mol |
| Exact Mass | 756.46 |
| IUPAC Name | 2-[2-[4-[3,3-bis(hydroxymethyl)hexoxy]-3-[2-(4-prop-1-en-2-yloxetan-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(CCc2ccc(CCCCC)cc2)ccc1-c1ccc(OCCC(CO)(CO)CCC)c(CCOC2CC(C(=C)C)O2)c1 |
| InChI | InChI=1S/C47H64O8/c1-7-9-10-11-36-12-14-37(15-13-36)16-17-38-18-20-41(44(29-38)52-27-28-54-46(50)35(5)6)39-19-21-42(51-26-24-47(32-48,33-49)23-8-2)40(30-39)22-25-53-45-31-43(55-45)34(3)4/h12-15,18-21,29-30,43,45,48-49H,3,5,7-11,16-17,22-28,31-33H2,1-2,4,6H3 |
| InChIKey | XZNKDRRVRWXRLW-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.02 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|