C42H60O5 — CID 118370263
2-[2-[3,3-bis(hydroxymethyl)-6,6-dimethylheptoxy]-5-[2-ethyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 118370263) has the molecular formula C42H60O5 and a molecular weight of 644.94 g/mol. Its IUPAC name is 2-[2-[3,3-bis(hydroxymethyl)-6,6-dimethylheptoxy]-5-[2-ethyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3,3-bis(hydroxymethyl)-6,6-dimethylheptoxy]-5-[2-ethyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118370263 |
| Molecular Formula | C42H60O5 |
| Molecular Weight | 644.94 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | 2-[2-[3,3-bis(hydroxymethyl)-6,6-dimethylheptoxy]-5-[2-ethyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(C3=CC=C(CCCCC)CC3)cc2CC)ccc1OCCC(CO)(CO)CCC(C)(C)C |
| InChI | InChI=1S/C42H60O5/c1-8-10-11-12-32-13-15-34(16-14-32)35-17-19-38(33(9-2)27-35)36-18-20-39(37(28-36)21-25-47-40(45)31(3)4)46-26-24-42(29-43,30-44)23-22-41(5,6)7/h13,15,17-20,27-28,43-44H,3,8-12,14,16,21-26,29-30H2,1-2,4-7H3 |
| InChIKey | ZVDWVMSFQBWUJN-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.94 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|