C47H66O8 — CID 134300281
2-[2-[4-[4,4-bis(hydroxymethyl)-5,5-dimethylhexoxy]-3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134300281) has the molecular formula C47H66O8 and a molecular weight of 759.04 g/mol. Its IUPAC name is 2-[2-[4-[4,4-bis(hydroxymethyl)-5,5-dimethylhexoxy]-3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-[4,4-bis(hydroxymethyl)-5,5-dimethylhexoxy]-3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134300281 |
| Molecular Formula | C47H66O8 |
| Molecular Weight | 759.04 g/mol |
| Exact Mass | 758.48 |
| IUPAC Name | 2-[2-[4-[4,4-bis(hydroxymethyl)-5,5-dimethylhexoxy]-3-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(CCc2ccc(CCCCC)cc2)ccc1-c1ccc(OCCCC(CO)(CO)C(C)(C)C)c(CCOC(O)C(=C)C)c1 |
| InChI | InChI=1S/C47H66O8/c1-9-10-11-13-36-14-16-37(17-15-36)18-19-38-20-22-41(43(30-38)53-28-29-55-45(51)35(4)5)39-21-23-42(40(31-39)24-27-54-44(50)34(2)3)52-26-12-25-47(32-48,33-49)46(6,7)8/h14-17,20-23,30-31,44,48-50H,2,4,9-13,18-19,24-29,32-33H2,1,3,5-8H3 |
| InChIKey | YPNZQRJQSDCSJR-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.04 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|