C32H32F6O — CID 123198490
5-[4-[2-[4-[4-(2-butoxy-1,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 123198490) has the molecular formula C32H32F6O and a molecular weight of 546.60 g/mol. Its IUPAC name is 5-[4-[2-[4-[4-(2-butoxy-1,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[2-[4-[4-(2-butoxy-1,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 123198490 |
| Molecular Formula | C32H32F6O |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 5-[4-[2-[4-[4-(2-butoxy-1,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCOC(F)=C(F)c1ccc(C2CCC(CCc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C32H32F6O/c1-2-3-16-39-32(38)30(36)24-13-11-23(12-14-24)22-9-6-20(7-10-22)4-5-21-8-15-26(27(33)17-21)25-18-28(34)31(37)29(35)19-25/h8,11-15,17-20,22H,2-7,9-10,16H2,1H3 |
| InChIKey | DVKUIAYCUYSEFM-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|