C23H30FN — CID 19101251
2-(2-fluoro-4-propylphenyl)-5-(4-propylcyclohexyl)pyridine (PubChem CID 19101251) has the molecular formula C23H30FN and a molecular weight of 339.50 g/mol. Its IUPAC name is 2-(2-fluoro-4-propylphenyl)-5-(4-propylcyclohexyl)pyridine.
| Compound Name | 2-(2-fluoro-4-propylphenyl)-5-(4-propylcyclohexyl)pyridine |
|---|---|
| PubChem CID | 19101251 |
| Molecular Formula | C23H30FN |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 2-(2-fluoro-4-propylphenyl)-5-(4-propylcyclohexyl)pyridine |
| SMILES | CCCc1ccc(-c2ccc(C3CCC(CCC)CC3)cn2)c(F)c1 |
| InChI | InChI=1S/C23H30FN/c1-3-5-17-7-10-19(11-8-17)20-12-14-23(25-16-20)21-13-9-18(6-4-2)15-22(21)24/h9,12-17,19H,3-8,10-11H2,1-2H3 |
| InChIKey | NLTLRSNNKYKYFO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |