C20H28F2 — CID 91310918
1-(4-ethenylcyclohexyl)-2,3-difluoro-4-hexan-2-ylbenzene (PubChem CID 91310918) has the molecular formula C20H28F2 and a molecular weight of 306.44 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-hexan-2-ylbenzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-hexan-2-ylbenzene |
|---|---|
| PubChem CID | 91310918 |
| Molecular Formula | C20H28F2 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-hexan-2-ylbenzene |
| SMILES | C=CC1CCC(c2ccc(C(C)CCCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H28F2/c1-4-6-7-14(3)17-12-13-18(20(22)19(17)21)16-10-8-15(5-2)9-11-16/h5,12-16H,2,4,6-11H2,1,3H3 |
| InChIKey | IJSUFELBGHFKGE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|