C28H27F3 — CID 67730556
2,3-difluoro-1-[4-[3-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-4-prop-2-enylbenzene (PubChem CID 67730556) has the molecular formula C28H27F3 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-4-prop-2-enylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 67730556 |
| Molecular Formula | C28H27F3 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(C4CCC(C)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H27F3/c1-3-4-22-13-16-25(28(31)27(22)30)21-11-9-19(10-12-21)23-14-15-24(26(29)17-23)20-7-5-18(2)6-8-20/h3,9-18,20H,1,4-8H2,2H3 |
| InChIKey | RNFBUTOEGRZYTF-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|