C29H29F3O2 — CID 89046005
5-[4-[4-[4-(but-3-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-methyloxane (PubChem CID 89046005) has the molecular formula C29H29F3O2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-[4-[4-[4-(but-3-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-methyloxane.
| Compound Name | 5-[4-[4-[4-(but-3-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-methyloxane |
|---|---|
| PubChem CID | 89046005 |
| Molecular Formula | C29H29F3O2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 5-[4-[4-[4-(but-3-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-methyloxane |
| SMILES | C=CCCOCc1ccc(-c2ccc(-c3ccc(C4CCC(C)OC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C29H29F3O2/c1-3-4-15-33-17-24-12-14-26(29(32)28(24)31)21-9-7-20(8-10-21)22-11-13-25(27(30)16-22)23-6-5-19(2)34-18-23/h3,7-14,16,19,23H,1,4-6,15,17-18H2,2H3 |
| InChIKey | MSOGCIJXUYFIIZ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|