C35H41F3O2 — CID 77344326
5-[4-[4-[4-(but-2-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-heptyloxane (PubChem CID 77344326) has the molecular formula C35H41F3O2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 5-[4-[4-[4-(but-2-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-heptyloxane.
| Compound Name | 5-[4-[4-[4-(but-2-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-heptyloxane |
|---|---|
| PubChem CID | 77344326 |
| Molecular Formula | C35H41F3O2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 5-[4-[4-[4-(but-2-enoxymethyl)-2,3-difluorophenyl]phenyl]-2-fluorophenyl]-2-heptyloxane |
| SMILES | CC=CCOCc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCCCC)OC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C35H41F3O2/c1-3-5-7-8-9-10-30-18-15-28(24-40-30)31-19-16-27(22-33(31)36)25-11-13-26(14-12-25)32-20-17-29(34(37)35(32)38)23-39-21-6-4-2/h4,6,11-14,16-17,19-20,22,28,30H,3,5,7-10,15,18,21,23-24H2,1-2H3 |
| InChIKey | LEJQQPVKYQUCAT-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|