C22H34F2 — CID 159485452
2,3-difluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]-4-prop-2-enylbenzene;molecular hydrogen (PubChem CID 159485452) has the molecular formula C22H34F2 and a molecular weight of 336.51 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]-4-prop-2-enylbenzene;molecular hydrogen.
| Compound Name | 2,3-difluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]-4-prop-2-enylbenzene;molecular hydrogen |
|---|---|
| PubChem CID | 159485452 |
| Molecular Formula | C22H34F2 |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 2,3-difluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]-4-prop-2-enylbenzene;molecular hydrogen |
| SMILES | C=CCc1ccc(C2CCC(C3CCC(C)CC3)CC2)c(F)c1F.[H][H].[H][H] |
| InChI | InChI=1S/C22H30F2.2H2/c1-3-4-19-13-14-20(22(24)21(19)23)18-11-9-17(10-12-18)16-7-5-15(2)6-8-16;;/h3,13-18H,1,4-12H2,2H3;2*1H |
| InChIKey | SERFKXARZJERRC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|