C24H34F2 — CID 126759201
1-[4-(4-ethyl-4-methylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enylbenzene (PubChem CID 126759201) has the molecular formula C24H34F2 and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-[4-(4-ethyl-4-methylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enylbenzene.
| Compound Name | 1-[4-(4-ethyl-4-methylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 126759201 |
| Molecular Formula | C24H34F2 |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-[4-(4-ethyl-4-methylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(C2CCC(C3CCC(C)(CC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C24H34F2/c1-4-6-20-11-12-21(23(26)22(20)25)19-9-7-17(8-10-19)18-13-15-24(3,5-2)16-14-18/h4,11-12,17-19H,1,5-10,13-16H2,2-3H3 |
| InChIKey | LTCCXJMWCGDULR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|