C15H18F2 — CID 90893098
1-ethenyl-2,3-difluoro-4-(4-methylcyclohexyl)benzene (PubChem CID 90893098) has the molecular formula C15H18F2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-ethenyl-2,3-difluoro-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-ethenyl-2,3-difluoro-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 90893098 |
| Molecular Formula | C15H18F2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-ethenyl-2,3-difluoro-4-(4-methylcyclohexyl)benzene |
| SMILES | C=Cc1ccc(C2CCC(C)CC2)c(F)c1F |
| InChI | InChI=1S/C15H18F2/c1-3-11-8-9-13(15(17)14(11)16)12-6-4-10(2)5-7-12/h3,8-10,12H,1,4-7H2,2H3 |
| InChIKey | DXJICHXKUCEFAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |