C15H18F2O — CID 20645953
1-ethenoxy-2,3-difluoro-4-(4-methylcyclohexyl)benzene (PubChem CID 20645953) has the molecular formula C15H18F2O and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-ethenoxy-2,3-difluoro-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-ethenoxy-2,3-difluoro-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 20645953 |
| Molecular Formula | C15H18F2O |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-ethenoxy-2,3-difluoro-4-(4-methylcyclohexyl)benzene |
| SMILES | C=COc1ccc(C2CCC(C)CC2)c(F)c1F |
| InChI | InChI=1S/C15H18F2O/c1-3-18-13-9-8-12(14(16)15(13)17)11-6-4-10(2)5-7-11/h3,8-11H,1,4-7H2,2H3 |
| InChIKey | IJYBLRQISPVCRU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|