C16H20F2O2 — CID 141349611
2,3-difluoro-1-methoxy-4-[4-(2-methoxyethenyl)cyclohexyl]benzene (PubChem CID 141349611) has the molecular formula C16H20F2O2 and a molecular weight of 282.33 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-[4-(2-methoxyethenyl)cyclohexyl]benzene.
| Compound Name | 2,3-difluoro-1-methoxy-4-[4-(2-methoxyethenyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 141349611 |
| Molecular Formula | C16H20F2O2 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-[4-(2-methoxyethenyl)cyclohexyl]benzene |
| SMILES | COC=CC1CCC(c2ccc(OC)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H20F2O2/c1-19-10-9-11-3-5-12(6-4-11)13-7-8-14(20-2)16(18)15(13)17/h7-12H,3-6H2,1-2H3 |
| InChIKey | LENQZROHYJJBBL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|