C22H30F2O2 — CID 58021332
5-[(E)-but-1-enyl]-2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]oxane (PubChem CID 58021332) has the molecular formula C22H30F2O2 and a molecular weight of 364.48 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]oxane.
| Compound Name | 5-[(E)-but-1-enyl]-2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 58021332 |
| Molecular Formula | C22H30F2O2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 5-[(E)-but-1-enyl]-2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]oxane |
| SMILES | CC/C=C/C1CCC(C2CCC(c3ccc(OC)c(F)c3F)CC2)OC1 |
| InChI | InChI=1S/C22H30F2O2/c1-3-4-5-15-6-12-19(26-14-15)17-9-7-16(8-10-17)18-11-13-20(25-2)22(24)21(18)23/h4-5,11,13,15-17,19H,3,6-10,12,14H2,1-2H3/b5-4+ |
| InChIKey | BDOISZJDIIWQDC-SNAWJCMRSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|