C17H24ClN2O2+ — CID 7290179
[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(4-chlorophenyl)carbamate (PubChem CID 7290179) has the molecular formula C17H24ClN2O2+ and a molecular weight of 323.84 g/mol. Its IUPAC name is [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(4-chlorophenyl)carbamate.
| Compound Name | [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 7290179 |
| Molecular Formula | C17H24ClN2O2+ |
| Molecular Weight | 323.84 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OC[C@H]1CCC[NH+]2CCCC[C@@H]12 |
| InChI | InChI=1S/C17H23ClN2O2/c18-14-6-8-15(9-7-14)19-17(21)22-12-13-4-3-11-20-10-2-1-5-16(13)20/h6-9,13,16H,1-5,10-12H2,(H,19,21)/p+1/t13-,16+/m1/s1 |
| InChIKey | GRDMMPXVOYPCJQ-CJNGLKHVSA-O |
| XLogP | 2.74 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |