C19H28NO3+ — CID 11860627
[(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-(4-methoxyphenyl)acetate (PubChem CID 11860627) has the molecular formula C19H28NO3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-(4-methoxyphenyl)acetate.
| Compound Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 11860627 |
| Molecular Formula | C19H28NO3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OC[C@H]2CCC[NH+]3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-22-17-9-7-15(8-10-17)13-19(21)23-14-16-5-4-12-20-11-3-2-6-18(16)20/h7-10,16,18H,2-6,11-14H2,1H3/p+1/t16-,18-/m1/s1 |
| InChIKey | IKCKHIMVLASZLO-SJLPKXTDSA-O |
| XLogP | 1.63 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |