C14H26NO2+ — CID 11874171
[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-methylpropanoate (PubChem CID 11874171) has the molecular formula C14H26NO2+ and a molecular weight of 240.37 g/mol. Its IUPAC name is [(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-methylpropanoate.
| Compound Name | [(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 11874171 |
| Molecular Formula | C14H26NO2+ |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@@H]1CCC[NH+]2CCCC[C@H]12 |
| InChI | InChI=1S/C14H25NO2/c1-11(2)14(16)17-10-12-6-5-9-15-8-4-3-7-13(12)15/h11-13H,3-10H2,1-2H3/p+1/t12-,13+/m0/s1 |
| InChIKey | OKDZSBOUVNBQMR-QWHCGFSZSA-O |
| XLogP | 1.03 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |