C13H25N2OS+ — CID 11872333
O-[[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] N-ethylcarbamothioate (PubChem CID 11872333) has the molecular formula C13H25N2OS+ and a molecular weight of 257.42 g/mol. Its IUPAC name is O-[[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] N-ethylcarbamothioate.
| Compound Name | O-[[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] N-ethylcarbamothioate |
|---|---|
| PubChem CID | 11872333 |
| Molecular Formula | C13H25N2OS+ |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | O-[[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] N-ethylcarbamothioate |
| SMILES | CCNC(=S)OC[C@@H]1CCC[NH+]2CCCC[C@H]12 |
| InChI | InChI=1S/C13H24N2OS/c1-2-14-13(17)16-10-11-6-5-9-15-8-4-3-7-12(11)15/h11-12H,2-10H2,1H3,(H,14,17)/p+1/t11-,12+/m0/s1 |
| InChIKey | YRHAROJFNDZGKJ-NWDGAFQWSA-O |
| XLogP | 0.74 |
| TPSA | 25.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|