C16H29BrNO2+ — CID 11873468
[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl (2R)-2-bromohexanoate (PubChem CID 11873468) has the molecular formula C16H29BrNO2+ and a molecular weight of 347.32 g/mol. Its IUPAC name is [(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl (2R)-2-bromohexanoate.
| Compound Name | [(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl (2R)-2-bromohexanoate |
|---|---|
| PubChem CID | 11873468 |
| Molecular Formula | C16H29BrNO2+ |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl (2R)-2-bromohexanoate |
| SMILES | CCCC[C@@H](Br)C(=O)OC[C@@H]1CCC[NH+]2CCCC[C@H]12 |
| InChI | InChI=1S/C16H28BrNO2/c1-2-3-8-14(17)16(19)20-12-13-7-6-11-18-10-5-4-9-15(13)18/h13-15H,2-12H2,1H3/p+1/t13-,14+,15+/m0/s1 |
| InChIKey | SZUFXALKOQDQRX-RRFJBIMHSA-O |
| XLogP | 2.33 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|