C15H31NO3P+ — CID 71966157
(1R,9aR)-1-[[butoxy(methyl)phosphoryl]oxymethyl]-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium (PubChem CID 71966157) has the molecular formula C15H31NO3P+ and a molecular weight of 304.39 g/mol. Its IUPAC name is (1R,9aR)-1-[[butoxy(methyl)phosphoryl]oxymethyl]-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium.
| Compound Name | (1R,9aR)-1-[[butoxy(methyl)phosphoryl]oxymethyl]-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium |
|---|---|
| PubChem CID | 71966157 |
| Molecular Formula | C15H31NO3P+ |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1R,9aR)-1-[[butoxy(methyl)phosphoryl]oxymethyl]-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium |
| SMILES | CCCCOP(C)(=O)OC[C@@H]1CCC[NH+]2CCCC[C@H]12 |
| InChI | InChI=1S/C15H30NO3P/c1-3-4-12-18-20(2,17)19-13-14-8-7-11-16-10-6-5-9-15(14)16/h14-15H,3-13H2,1-2H3/p+1/t14-,15+,20?/m0/s1 |
| InChIKey | MHYQTYYTGDIMIE-VKWYCSODSA-O |
| XLogP | 2.49 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|