C17H24ClN2O5S+ — CID 4184658
1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-ylmethyl N-(4-chlorophenoxy)sulfonylcarbamate (PubChem CID 4184658) has the molecular formula C17H24ClN2O5S+ and a molecular weight of 403.91 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-ylmethyl N-(4-chlorophenoxy)sulfonylcarbamate.
| Compound Name | 1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-ylmethyl N-(4-chlorophenoxy)sulfonylcarbamate |
|---|---|
| PubChem CID | 4184658 |
| Molecular Formula | C17H24ClN2O5S+ |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-ylmethyl N-(4-chlorophenoxy)sulfonylcarbamate |
| SMILES | O=C(NS(=O)(=O)Oc1ccc(Cl)cc1)OCC1CCC[NH+]2CCCCC12 |
| InChI | InChI=1S/C17H23ClN2O5S/c18-14-6-8-15(9-7-14)25-26(22,23)19-17(21)24-12-13-4-3-11-20-10-2-1-5-16(13)20/h6-9,13,16H,1-5,10-12H2,(H,19,21)/p+1 |
| InChIKey | MZLRSFBNYSKEPU-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |