C19H26FNO3S — CID 55312583
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 55312583) has the molecular formula C19H26FNO3S and a molecular weight of 367.49 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 55312583 |
| Molecular Formula | C19H26FNO3S |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | CCN(C(=O)COC(=O)CCSc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C19H26FNO3S/c1-2-21(16-6-4-3-5-7-16)18(22)14-24-19(23)12-13-25-17-10-8-15(20)9-11-17/h8-11,16H,2-7,12-14H2,1H3 |
| InChIKey | ZXDWTNJYGVQJKQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |