C17H16ClFN2O4S — CID 55484876
[1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)propanoate (PubChem CID 55484876) has the molecular formula C17H16ClFN2O4S and a molecular weight of 398.84 g/mol. Its IUPAC name is [1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 55484876 |
| Molecular Formula | C17H16ClFN2O4S |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)propanoate |
| SMILES | CC(NC(=O)c1cccs1)C(=O)OC(C)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C17H16ClFN2O4S/c1-9(20-16(23)14-4-3-7-26-14)17(24)25-10(2)15(22)21-13-6-5-11(18)8-12(13)19/h3-10H,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | FBXYCLFFGIESES-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |