C20H16ClFN2O2S — CID 55345705
N-[1-(4-chloro-2-fluoroanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide (PubChem CID 55345705) has the molecular formula C20H16ClFN2O2S and a molecular weight of 402.88 g/mol. Its IUPAC name is N-[1-(4-chloro-2-fluoroanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-chloro-2-fluoroanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55345705 |
| Molecular Formula | C20H16ClFN2O2S |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[1-(4-chloro-2-fluoroanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Nc1ccc(Cl)cc1F)c1cccs1 |
| InChI | InChI=1S/C20H16ClFN2O2S/c21-14-8-9-16(15(22)12-14)23-19(25)17(11-13-5-2-1-3-6-13)24-20(26)18-7-4-10-27-18/h1-10,12,17H,11H2,(H,23,25)(H,24,26) |
| InChIKey | MUUIUTFEQMBMOA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |