C22H19N3O2S — CID 118296458
N-[1-(1H-indol-7-ylamino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide (PubChem CID 118296458) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[1-(1H-indol-7-ylamino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(1H-indol-7-ylamino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 118296458 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[1-(1H-indol-7-ylamino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Nc1cccc2cc[nH]c12)c1cccs1 |
| InChI | InChI=1S/C22H19N3O2S/c26-21(24-17-9-4-8-16-11-12-23-20(16)17)18(14-15-6-2-1-3-7-15)25-22(27)19-10-5-13-28-19/h1-13,18,23H,14H2,(H,24,26)(H,25,27) |
| InChIKey | ORROUQITINWVTO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |