C28H34N2O3S — CID 112789572
N-[1-(1-adamantyl)ethyl]-2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 112789572) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 112789572 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COc1cccc(NC(=O)CSc2ccccc2C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C28H34N2O3S/c1-18(28-14-19-10-20(15-28)12-21(11-19)16-28)29-27(32)24-8-3-4-9-25(24)34-17-26(31)30-22-6-5-7-23(13-22)33-2/h3-9,13,18-21H,10-12,14-17H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | PFTFCTDHWDPDDL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |