C26H28N2O3S — CID 86941756
N-[1-(3-methoxyphenyl)propan-2-yl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 86941756) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)propan-2-yl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-[1-(3-methoxyphenyl)propan-2-yl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 86941756 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[1-(3-methoxyphenyl)propan-2-yl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COc1cccc(CC(C)NC(=O)c2ccccc2SCC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-18-11-13-21(14-12-18)28-25(29)17-32-24-10-5-4-9-23(24)26(30)27-19(2)15-20-7-6-8-22(16-20)31-3/h4-14,16,19H,15,17H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | IJCMVZHVGXBYAK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |