C20H24ClN3O3S — CID 119451413
2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-N-pyrrolidin-3-ylbenzamide;hydrochloride (PubChem CID 119451413) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-N-pyrrolidin-3-ylbenzamide;hydrochloride.
| Compound Name | 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-N-pyrrolidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119451413 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-N-pyrrolidin-3-ylbenzamide;hydrochloride |
| SMILES | COc1cccc(NC(=O)CSc2ccccc2C(=O)NC2CCNC2)c1.Cl |
| InChI | InChI=1S/C20H23N3O3S.ClH/c1-26-16-6-4-5-14(11-16)22-19(24)13-27-18-8-3-2-7-17(18)20(25)23-15-9-10-21-12-15;/h2-8,11,15,21H,9-10,12-13H2,1H3,(H,22,24)(H,23,25);1H |
| InChIKey | RLSUJAXZNIRODM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |