C20H24ClFN2O2 — CID 108509156
N'-[1-(1-adamantyl)ethyl]-N-(3-chloro-4-fluorophenyl)oxamide (PubChem CID 108509156) has the molecular formula C20H24ClFN2O2 and a molecular weight of 378.88 g/mol. Its IUPAC name is N'-[1-(1-adamantyl)ethyl]-N-(3-chloro-4-fluorophenyl)oxamide.
| Compound Name | N'-[1-(1-adamantyl)ethyl]-N-(3-chloro-4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 108509156 |
| Molecular Formula | C20H24ClFN2O2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N'-[1-(1-adamantyl)ethyl]-N-(3-chloro-4-fluorophenyl)oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccc(F)c(Cl)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24ClFN2O2/c1-11(20-8-12-4-13(9-20)6-14(5-12)10-20)23-18(25)19(26)24-15-2-3-17(22)16(21)7-15/h2-3,7,11-14H,4-6,8-10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | RANYFOSGXRTBAO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|