C17H22Cl2N+ — CID 7311417
2-adamantyl-[(2,4-dichlorophenyl)methyl]azanium (PubChem CID 7311417) has the molecular formula C17H22Cl2N+ and a molecular weight of 311.28 g/mol. Its IUPAC name is 2-adamantyl-[(2,4-dichlorophenyl)methyl]azanium.
| Compound Name | 2-adamantyl-[(2,4-dichlorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7311417 |
| Molecular Formula | C17H22Cl2N+ |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-adamantyl-[(2,4-dichlorophenyl)methyl]azanium |
| SMILES | Clc1ccc(C[NH2+]C2C3CC4CC(C3)CC2C4)c(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2N/c18-15-2-1-12(16(19)8-15)9-20-17-13-4-10-3-11(6-13)7-14(17)5-10/h1-2,8,10-11,13-14,17,20H,3-7,9H2/p+1 |
| InChIKey | TWCKQZJPZIOAMS-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |