C25H31ClNO2+ — CID 7924031
2-adamantyl-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]azanium (PubChem CID 7924031) has the molecular formula C25H31ClNO2+ and a molecular weight of 412.98 g/mol. Its IUPAC name is 2-adamantyl-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]azanium.
| Compound Name | 2-adamantyl-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]azanium |
|---|---|
| PubChem CID | 7924031 |
| Molecular Formula | C25H31ClNO2+ |
| Molecular Weight | 412.98 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-adamantyl-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]azanium |
| SMILES | COc1cccc(C[NH2+]C2C3CC4CC(C3)CC2C4)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClNO2/c1-28-23-4-2-3-19(25(23)29-15-16-5-7-22(26)8-6-16)14-27-24-20-10-17-9-18(12-20)13-21(24)11-17/h2-8,17-18,20-21,24,27H,9-15H2,1H3/p+1 |
| InChIKey | UUZHDALQZGIORD-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.98 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |