C20H20ClNO2S — CID 4716137
1-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(thiophen-2-ylmethyl)methanamine (PubChem CID 4716137) has the molecular formula C20H20ClNO2S and a molecular weight of 373.91 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(thiophen-2-ylmethyl)methanamine.
| Compound Name | 1-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(thiophen-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 4716137 |
| Molecular Formula | C20H20ClNO2S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(thiophen-2-ylmethyl)methanamine |
| SMILES | COc1cccc(CNCc2cccs2)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO2S/c1-23-19-6-2-4-16(12-22-13-18-5-3-11-25-18)20(19)24-14-15-7-9-17(21)10-8-15/h2-11,22H,12-14H2,1H3 |
| InChIKey | LVVNEHBGCRKELG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |