C15H19NO2S — CID 43221014
1-(3-ethoxy-2-methoxyphenyl)-N-(thiophen-2-ylmethyl)methanamine (PubChem CID 43221014) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 1-(3-ethoxy-2-methoxyphenyl)-N-(thiophen-2-ylmethyl)methanamine.
| Compound Name | 1-(3-ethoxy-2-methoxyphenyl)-N-(thiophen-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 43221014 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(3-ethoxy-2-methoxyphenyl)-N-(thiophen-2-ylmethyl)methanamine |
| SMILES | CCOc1cccc(CNCc2cccs2)c1OC |
| InChI | InChI=1S/C15H19NO2S/c1-3-18-14-8-4-6-12(15(14)17-2)10-16-11-13-7-5-9-19-13/h4-9,16H,3,10-11H2,1-2H3 |
| InChIKey | CYAFQSBAYGKMSU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |