C18H25ClNO+ — CID 8621718
2-adamantyl-[(5-chloro-2-methoxyphenyl)methyl]azanium (PubChem CID 8621718) has the molecular formula C18H25ClNO+ and a molecular weight of 306.86 g/mol. Its IUPAC name is 2-adamantyl-[(5-chloro-2-methoxyphenyl)methyl]azanium.
| Compound Name | 2-adamantyl-[(5-chloro-2-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8621718 |
| Molecular Formula | C18H25ClNO+ |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-adamantyl-[(5-chloro-2-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH2+]C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H24ClNO/c1-21-17-3-2-16(19)9-15(17)10-20-18-13-5-11-4-12(7-13)8-14(18)6-11/h2-3,9,11-14,18,20H,4-8,10H2,1H3/p+1 |
| InChIKey | RUWYUTMKPNYAHG-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |