C15H19BrClNO — CID 80669272
3-bromo-8-[(5-chloro-2-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octane (PubChem CID 80669272) has the molecular formula C15H19BrClNO and a molecular weight of 344.68 g/mol. Its IUPAC name is 3-bromo-8-[(5-chloro-2-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-bromo-8-[(5-chloro-2-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 80669272 |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-bromo-8-[(5-chloro-2-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octane |
| SMILES | COc1ccc(Cl)cc1CN1C2CCC1CC(Br)C2 |
| InChI | InChI=1S/C15H19BrClNO/c1-19-15-5-2-12(17)6-10(15)9-18-13-3-4-14(18)8-11(16)7-13/h2,5-6,11,13-14H,3-4,7-9H2,1H3 |
| InChIKey | GMGCZZOVUOBRTL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|