C16H22BrNO — CID 80668841
3-bromo-8-[(2-methoxy-5-methylphenyl)methyl]-8-azabicyclo[3.2.1]octane (PubChem CID 80668841) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 3-bromo-8-[(2-methoxy-5-methylphenyl)methyl]-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-bromo-8-[(2-methoxy-5-methylphenyl)methyl]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 80668841 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-bromo-8-[(2-methoxy-5-methylphenyl)methyl]-8-azabicyclo[3.2.1]octane |
| SMILES | COc1ccc(C)cc1CN1C2CCC1CC(Br)C2 |
| InChI | InChI=1S/C16H22BrNO/c1-11-3-6-16(19-2)12(7-11)10-18-14-4-5-15(18)9-13(17)8-14/h3,6-7,13-15H,4-5,8-10H2,1-2H3 |
| InChIKey | XAYVBTQDBJOQCK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|