C20H29ClNO+ — CID 8621699
[(1S)-1-(1-adamantyl)ethyl]-[(5-chloro-2-methoxyphenyl)methyl]azanium (PubChem CID 8621699) has the molecular formula C20H29ClNO+ and a molecular weight of 334.91 g/mol. Its IUPAC name is [(1S)-1-(1-adamantyl)ethyl]-[(5-chloro-2-methoxyphenyl)methyl]azanium.
| Compound Name | [(1S)-1-(1-adamantyl)ethyl]-[(5-chloro-2-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8621699 |
| Molecular Formula | C20H29ClNO+ |
| Molecular Weight | 334.91 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [(1S)-1-(1-adamantyl)ethyl]-[(5-chloro-2-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH2+][C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28ClNO/c1-13(22-12-17-8-18(21)3-4-19(17)23-2)20-9-14-5-15(10-20)7-16(6-14)11-20/h3-4,8,13-16,22H,5-7,9-12H2,1-2H3/p+1/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | JHOZVVORNBQQOH-IVKJLDKCSA-O |
| XLogP | 4.02 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |