C16H20BrClO — CID 66047756
2-(bromomethyl)-2-[(5-chloro-2-methoxyphenyl)methyl]bicyclo[2.2.1]heptane (PubChem CID 66047756) has the molecular formula C16H20BrClO and a molecular weight of 343.69 g/mol. Its IUPAC name is 2-(bromomethyl)-2-[(5-chloro-2-methoxyphenyl)methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-(bromomethyl)-2-[(5-chloro-2-methoxyphenyl)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 66047756 |
| Molecular Formula | C16H20BrClO |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(bromomethyl)-2-[(5-chloro-2-methoxyphenyl)methyl]bicyclo[2.2.1]heptane |
| SMILES | COc1ccc(Cl)cc1CC1(CBr)CC2CCC1C2 |
| InChI | InChI=1S/C16H20BrClO/c1-19-15-5-4-14(18)7-12(15)9-16(10-17)8-11-2-3-13(16)6-11/h4-5,7,11,13H,2-3,6,8-10H2,1H3 |
| InChIKey | ACFZPJIUGSBNTR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|