C16H19Cl2NO — CID 100605785
N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dichlorophenyl)propanamide (PubChem CID 100605785) has the molecular formula C16H19Cl2NO and a molecular weight of 312.24 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100605785 |
| Molecular Formula | C16H19Cl2NO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)N[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C16H19Cl2NO/c17-13-5-3-11(14(18)9-13)4-6-16(20)19-15-8-10-1-2-12(15)7-10/h3,5,9-10,12,15H,1-2,4,6-8H2,(H,19,20)/t10-,12-,15-/m1/s1 |
| InChIKey | YMEUNSOACZTPFD-IXPVHAAZSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |