C14H17NO2S — CID 171950411
(5-methyl-3-pyridinyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171950411) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (5-methyl-3-pyridinyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | (5-methyl-3-pyridinyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171950411 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (5-methyl-3-pyridinyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | Cc1cncc(C(=O)C2CC3CCC(C2)S3=O)c1 |
| InChI | InChI=1S/C14H17NO2S/c1-9-4-11(8-15-7-9)14(16)10-5-12-2-3-13(6-10)18(12)17/h4,7-8,10,12-13H,2-3,5-6H2,1H3 |
| InChIKey | BVELHWQXQMRENH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |