C14H14N2O2S — CID 171944124
5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)pyridine-2-carbonitrile (PubChem CID 171944124) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)pyridine-2-carbonitrile.
| Compound Name | 5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171944124 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(C(=O)C2CC3CCC(C2)S3=O)cn1 |
| InChI | InChI=1S/C14H14N2O2S/c15-7-11-2-1-9(8-16-11)14(17)10-5-12-3-4-13(6-10)19(12)18/h1-2,8,10,12-13H,3-6H2 |
| InChIKey | KKWUENQXOPTOJY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |