C16H21NO2S — CID 171946466
[3-(dimethylamino)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171946466) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | [3-(dimethylamino)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171946466 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [3-(dimethylamino)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | CN(C)c1cccc(C(=O)C2CC3CCC(C2)S3=O)c1 |
| InChI | InChI=1S/C16H21NO2S/c1-17(2)13-5-3-4-11(8-13)16(18)12-9-14-6-7-15(10-12)20(14)19/h3-5,8,12,14-15H,6-7,9-10H2,1-2H3 |
| InChIKey | UTPVKWQRYCNONJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |