C24H28N2O3 — CID 171946462
benzyl 3-[3-(dimethylamino)benzoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171946462) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is benzyl 3-[3-(dimethylamino)benzoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-[3-(dimethylamino)benzoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171946462 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | benzyl 3-[3-(dimethylamino)benzoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CN(C)c1cccc(C(=O)C2CC3CCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-25(2)20-10-6-9-18(13-20)23(27)19-14-21-11-12-22(15-19)26(21)24(28)29-16-17-7-4-3-5-8-17/h3-10,13,19,21-22H,11-12,14-16H2,1-2H3 |
| InChIKey | HECBTAMKXXKABV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |