C21H23N3O4 — CID 171943896
benzyl 3-(2-methoxypyrimidine-5-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171943896) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is benzyl 3-(2-methoxypyrimidine-5-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-(2-methoxypyrimidine-5-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171943896 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | benzyl 3-(2-methoxypyrimidine-5-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1ncc(C(=O)C2CC3CCC(C2)N3C(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C21H23N3O4/c1-27-20-22-11-16(12-23-20)19(25)15-9-17-7-8-18(10-15)24(17)21(26)28-13-14-5-3-2-4-6-14/h2-6,11-12,15,17-18H,7-10,13H2,1H3 |
| InChIKey | NMCQYOCKBCYSQY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |