C25H31NO3Si — CID 171941339
benzyl 3-(3-trimethylsilylbenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171941339) has the molecular formula C25H31NO3Si and a molecular weight of 421.61 g/mol. Its IUPAC name is benzyl 3-(3-trimethylsilylbenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-(3-trimethylsilylbenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171941339 |
| Molecular Formula | C25H31NO3Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | benzyl 3-(3-trimethylsilylbenzoyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C[Si](C)(C)c1cccc(C(=O)C2CC3CCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H31NO3Si/c1-30(2,3)23-11-7-10-19(16-23)24(27)20-14-21-12-13-22(15-20)26(21)25(28)29-17-18-8-5-4-6-9-18/h4-11,16,20-22H,12-15,17H2,1-3H3 |
| InChIKey | LVUIKWKQWBIXCX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|