C25H27NO3 — CID 171944493
benzyl 3-(3-ethenylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171944493) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is benzyl 3-(3-ethenylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-(3-ethenylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171944493 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | benzyl 3-(3-ethenylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C=Cc1cccc(C(=O)C2CC3CCCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H27NO3/c1-2-18-10-6-11-20(14-18)24(27)21-15-22-12-7-13-23(16-21)26(22)25(28)29-17-19-8-4-3-5-9-19/h2-6,8-11,14,21-23H,1,7,12-13,15-17H2 |
| InChIKey | YRXJBULABCXTIQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |