C25H25NO3 — CID 171944666
benzyl 3-(4-ethynylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171944666) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is benzyl 3-(4-ethynylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-(4-ethynylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171944666 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | benzyl 3-(4-ethynylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C#Cc1ccc(C(=O)C2CC3CCCC(C2)N3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO3/c1-2-18-11-13-20(14-12-18)24(27)21-15-22-9-6-10-23(16-21)26(22)25(28)29-17-19-7-4-3-5-8-19/h1,3-5,7-8,11-14,21-23H,6,9-10,15-17H2 |
| InChIKey | DSCBTYKXBSKBMU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|